C31H31F2NO2Ti — CID 10530321
(6Z)-2-tert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one;difluorotitanium (PubChem CID 10530321) has the molecular formula C31H31F2NO2Ti and a molecular weight of 535.46 g/mol. Its IUPAC name is (6Z)-2-tert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one;difluorotitanium.
| Compound Name | (6Z)-2-tert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one;difluorotitanium |
|---|---|
| PubChem CID | 10530321 |
| Molecular Formula | C31H31F2NO2Ti |
| Molecular Weight | 535.46 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | (6Z)-2-tert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one;difluorotitanium |
| SMILES | CC(C)(C)C1=CC=C/C(=C/N[C@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)C1=O.F[Ti]F |
| InChI | InChI=1S/C31H31NO2.2FH.Ti/c1-30(2,3)27-21-13-16-24(28(27)33)22-32-29(23-14-7-4-8-15-23)31(34,25-17-9-5-10-18-25)26-19-11-6-12-20-26;;;/h4-22,29,32,34H,1-3H3;2*1H;/q;;;+2/p-2/b24-22-;;;/t29-;;;/m1.../s1 |
| InChIKey | HKPPHOLKGHSHHM-LVVUNVNTSA-L |
| XLogP | 7.09 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.46 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|