C29H27F2NO4Ti — CID 11261179
difluorotitanium;(6Z)-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]-2,4-dimethoxycyclohexa-2,4-dien-1-one (PubChem CID 11261179) has the molecular formula C29H27F2NO4Ti and a molecular weight of 539.40 g/mol. Its IUPAC name is difluorotitanium;(6Z)-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]-2,4-dimethoxycyclohexa-2,4-dien-1-one.
| Compound Name | difluorotitanium;(6Z)-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]-2,4-dimethoxycyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 11261179 |
| Molecular Formula | C29H27F2NO4Ti |
| Molecular Weight | 539.40 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | difluorotitanium;(6Z)-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]-2,4-dimethoxycyclohexa-2,4-dien-1-one |
| SMILES | COC1=C/C(=C/N[C@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)C(=O)C(OC)=C1.F[Ti]F |
| InChI | InChI=1S/C29H27NO4.2FH.Ti/c1-33-25-18-22(27(31)26(19-25)34-2)20-30-28(21-12-6-3-7-13-21)29(32,23-14-8-4-9-15-23)24-16-10-5-11-17-24;;;/h3-20,28,30,32H,1-2H3;2*1H;/q;;;+2/p-2/b22-20-;;;/t28-;;;/m1.../s1 |
| InChIKey | MCGTYAMWMQXTGA-WTACTRKHSA-L |
| XLogP | 5.62 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.40 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|