C62H62N2O4Ti — CID 10653434
bis((6Z)-2-tert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one);titanium (PubChem CID 10653434) has the molecular formula C62H62N2O4Ti and a molecular weight of 947.06 g/mol. Its IUPAC name is bis((6Z)-2-tert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one);titanium.
| Compound Name | bis((6Z)-2-tert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one);titanium |
|---|---|
| PubChem CID | 10653434 |
| Molecular Formula | C62H62N2O4Ti |
| Molecular Weight | 947.06 g/mol |
| Exact Mass | 946.42 |
| IUPAC Name | bis((6Z)-2-tert-butyl-6-[[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]methylidene]cyclohexa-2,4-dien-1-one);titanium |
| SMILES | CC(C)(C)C1=CC=C/C(=C/N[C@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)C1=O.CC(C)(C)C1=CC=C/C(=C/N[C@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)C1=O.[Ti] |
| InChI | InChI=1S/2C31H31NO2.Ti/c2*1-30(2,3)27-21-13-16-24(28(27)33)22-32-29(23-14-7-4-8-15-23)31(34,25-17-9-5-10-18-25)26-19-11-6-12-20-26;/h2*4-22,29,32,34H,1-3H3;/b2*24-22-;/t2*29-;/m11./s1 |
| InChIKey | JZOHBKLSZFRMTQ-IDTXKQQKSA-N |
| XLogP | 12.49 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.06 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|