C28H27NO4 — CID 15536683
3-butoxy-4-[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 15536683) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 3-butoxy-4-[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-butoxy-4-[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 15536683 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 3-butoxy-4-[[(1R)-2-hydroxy-1,2,2-triphenylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CCCCOc1c(N[C@H](c2ccccc2)C(O)(c2ccccc2)c2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C28H27NO4/c1-2-3-19-33-26-23(24(30)25(26)31)29-27(20-13-7-4-8-14-20)28(32,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h4-18,27,29,32H,2-3,19H2,1H3/t27-/m1/s1 |
| InChIKey | ZMTNALGZIXKEEC-HHHXNRCGSA-N |
| XLogP | 4.55 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|