C22H23NO4 — CID 15525793
3-butoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 15525793) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is 3-butoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-butoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 15525793 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-butoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CCCCOc1c(N[C@H](c2ccccc2)[C@@H](O)c2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C22H23NO4/c1-2-3-14-27-22-18(20(25)21(22)26)23-17(15-10-6-4-7-11-15)19(24)16-12-8-5-9-13-16/h4-13,17,19,23-24H,2-3,14H2,1H3/t17-,19+/m1/s1 |
| InChIKey | PIGPUMUQSKQGKB-MJGOQNOKSA-N |
| XLogP | 3.35 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|