C18H15NO3S — CID 15525800
3-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]-4-sulfanylcyclobut-3-ene-1,2-dione (PubChem CID 15525800) has the molecular formula C18H15NO3S and a molecular weight of 325.39 g/mol. Its IUPAC name is 3-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]-4-sulfanylcyclobut-3-ene-1,2-dione.
| Compound Name | 3-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]-4-sulfanylcyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 15525800 |
| Molecular Formula | C18H15NO3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.08 |
| IUPAC Name | 3-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]-4-sulfanylcyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(S)c(N[C@H](c2ccccc2)[C@@H](O)c2ccccc2)c1=O |
| InChI | InChI=1S/C18H15NO3S/c20-15(12-9-5-2-6-10-12)13(11-7-3-1-4-8-11)19-14-16(21)17(22)18(14)23/h1-10,13,15,19-20,23H/t13-,15+/m1/s1 |
| InChIKey | XPDRTHRULXQOSD-HIFRSBDPSA-N |
| XLogP | 2.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|