C20H19NO4 — CID 15525791
3-ethoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 15525791) has the molecular formula C20H19NO4 and a molecular weight of 337.38 g/mol. Its IUPAC name is 3-ethoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-ethoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 15525791 |
| Molecular Formula | C20H19NO4 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 3-ethoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CCOc1c(N[C@H](c2ccccc2)[C@@H](O)c2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C20H19NO4/c1-2-25-20-16(18(23)19(20)24)21-15(13-9-5-3-6-10-13)17(22)14-11-7-4-8-12-14/h3-12,15,17,21-22H,2H2,1H3/t15-,17+/m1/s1 |
| InChIKey | JYOXVRUISNLELR-WBVHZDCISA-N |
| XLogP | 2.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|