C40H38N2O8 — CID 139057585
3-ethoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione (PubChem CID 139057585) has the molecular formula C40H38N2O8 and a molecular weight of 674.75 g/mol. Its IUPAC name is 3-ethoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-ethoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 139057585 |
| Molecular Formula | C40H38N2O8 |
| Molecular Weight | 674.75 g/mol |
| Exact Mass | 674.26 |
| IUPAC Name | 3-ethoxy-4-[[(1R,2S)-2-hydroxy-1,2-diphenylethyl]amino]cyclobut-3-ene-1,2-dione |
| SMILES | CCOc1c(N[C@H](c2ccccc2)[C@@H](O)c2ccccc2)c(=O)c1=O.CCOc1c(N[C@H](c2ccccc2)[C@@H](O)c2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/2C20H19NO4/c2*1-2-25-20-16(18(23)19(20)24)21-15(13-9-5-3-6-10-13)17(22)14-11-7-4-8-12-14/h2*3-12,15,17,21-22H,2H2,1H3/t2*15-,17+/m11/s1 |
| InChIKey | WASUXBYFWNXIKP-GGINKKKESA-N |
| XLogP | 5.14 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.75 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|