C25H21NO4 — CID 5231851
3-[(2-hydroxy-1,2-diphenylethyl)amino]-4-phenylmethoxycyclobut-3-ene-1,2-dione (PubChem CID 5231851) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 3-[(2-hydroxy-1,2-diphenylethyl)amino]-4-phenylmethoxycyclobut-3-ene-1,2-dione.
| Compound Name | 3-[(2-hydroxy-1,2-diphenylethyl)amino]-4-phenylmethoxycyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 5231851 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 3-[(2-hydroxy-1,2-diphenylethyl)amino]-4-phenylmethoxycyclobut-3-ene-1,2-dione |
| SMILES | O=c1c(NC(c2ccccc2)C(O)c2ccccc2)c(OCc2ccccc2)c1=O |
| InChI | InChI=1S/C25H21NO4/c27-22(19-14-8-3-9-15-19)20(18-12-6-2-7-13-18)26-21-23(28)24(29)25(21)30-16-17-10-4-1-5-11-17/h1-15,20,22,26-27H,16H2 |
| InChIKey | WOBOBIFCZYTKPU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|