C25H27NO4 — CID 5231852
3-butoxy-4-[2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione (PubChem CID 5231852) has the molecular formula C25H27NO4 and a molecular weight of 405.49 g/mol. Its IUPAC name is 3-butoxy-4-[2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione.
| Compound Name | 3-butoxy-4-[2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 5231852 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | 3-butoxy-4-[2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]cyclobut-3-ene-1,2-dione |
| SMILES | CCCCOc1c(N2CCCC2C(O)(c2ccccc2)c2ccccc2)c(=O)c1=O |
| InChI | InChI=1S/C25H27NO4/c1-2-3-17-30-24-21(22(27)23(24)28)26-16-10-15-20(26)25(29,18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14,20,29H,2-3,10,15-17H2,1H3 |
| InChIKey | NSOKODSAGZEJSW-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|