C50H16F18N8 — CID 10534171
10,15-bis(2,3,4,5,6-pentafluorophenyl)-5,20-bis(2,3,5,6-tetrafluoro-4-pyrazol-1-ylphenyl)-21,22-dihydroporphyrin (PubChem CID 10534171) has the molecular formula C50H16F18N8 and a molecular weight of 1070.70 g/mol. Its IUPAC name is 10,15-bis(2,3,4,5,6-pentafluorophenyl)-5,20-bis(2,3,5,6-tetrafluoro-4-pyrazol-1-ylphenyl)-21,22-dihydroporphyrin.
| Compound Name | 10,15-bis(2,3,4,5,6-pentafluorophenyl)-5,20-bis(2,3,5,6-tetrafluoro-4-pyrazol-1-ylphenyl)-21,22-dihydroporphyrin |
|---|---|
| PubChem CID | 10534171 |
| Molecular Formula | C50H16F18N8 |
| Molecular Weight | 1070.70 g/mol |
| Exact Mass | 1070.12 |
| IUPAC Name | 10,15-bis(2,3,4,5,6-pentafluorophenyl)-5,20-bis(2,3,5,6-tetrafluoro-4-pyrazol-1-ylphenyl)-21,22-dihydroporphyrin |
| SMILES | Fc1c(F)c(F)c(-c2c3nc(c(-c4c(F)c(F)c(F)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(-n5cccn5)c(F)c4F)c4ccc([nH]4)c(-c4c(F)c(F)c(-n5cccn5)c(F)c4F)c4nc2C=C4)C=C3)c(F)c1F |
| InChI | InChI=1S/C50H16F18N8/c51-31-27(32(52)40(60)43(63)39(31)59)23-15-3-4-16(71-15)24(28-33(53)41(61)44(64)42(62)34(28)54)18-6-8-20(73-18)26(30-37(57)47(67)50(48(68)38(30)58)76-14-2-12-70-76)22-10-9-21(74-22)25(19-7-5-17(23)72-19)29-35(55)45(65)49(46(66)36(29)56)75-13-1-11-69-75/h1-14,72,74H/b23-15+,23-17+,24-16+,24-18+,25-19+,25-21+,26-20+,26-22+ |
| InChIKey | NIAZCSHLQPBLBC-ACMQTNTFSA-N |
| XLogP | 14.20 |
| TPSA | 93.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1070.70 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|