C9H12BrN5S — CID 105342123
[(4-bromo-1-methylpyrazol-5-yl)-(4-methyl-1,3-thiazol-5-yl)methyl]hydrazine (PubChem CID 105342123) has the molecular formula C9H12BrN5S and a molecular weight of 302.20 g/mol. Its IUPAC name is [(4-bromo-1-methylpyrazol-5-yl)-(4-methyl-1,3-thiazol-5-yl)methyl]hydrazine.
| Compound Name | [(4-bromo-1-methylpyrazol-5-yl)-(4-methyl-1,3-thiazol-5-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105342123 |
| Molecular Formula | C9H12BrN5S |
| Molecular Weight | 302.20 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | [(4-bromo-1-methylpyrazol-5-yl)-(4-methyl-1,3-thiazol-5-yl)methyl]hydrazine |
| SMILES | Cc1ncsc1C(NN)c1c(Br)cnn1C |
| InChI | InChI=1S/C9H12BrN5S/c1-5-9(16-4-12-5)7(14-11)8-6(10)3-13-15(8)2/h3-4,7,14H,11H2,1-2H3 |
| InChIKey | HCSZBWWYBTZBIK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.20 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|