C12H11Cl3O2 — CID 105349156
(5-methyloxolan-3-yl)-(2,4,6-trichlorophenyl)methanone (PubChem CID 105349156) has the molecular formula C12H11Cl3O2 and a molecular weight of 293.58 g/mol. Its IUPAC name is (5-methyloxolan-3-yl)-(2,4,6-trichlorophenyl)methanone.
| Compound Name | (5-methyloxolan-3-yl)-(2,4,6-trichlorophenyl)methanone |
|---|---|
| PubChem CID | 105349156 |
| Molecular Formula | C12H11Cl3O2 |
| Molecular Weight | 293.58 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | (5-methyloxolan-3-yl)-(2,4,6-trichlorophenyl)methanone |
| SMILES | CC1CC(C(=O)c2c(Cl)cc(Cl)cc2Cl)CO1 |
| InChI | InChI=1S/C12H11Cl3O2/c1-6-2-7(5-17-6)12(16)11-9(14)3-8(13)4-10(11)15/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | SKVIEVLMJQEEKJ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |