2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid

C9H13NO2S2 — CID 105352893

IUPAC2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid
SMILESCCC(SCc1nc(C)cs1)C(=O)O
InChIInChI=1S/C9H13NO2S2/c1-3-7(9(11)12)13-5-8-10-6(2)4-14-8/h4,7H,3,5H2,1-2H3,(H,11,12)
InChIKeyFBDWXQCARUVNCD-UHFFFAOYSA-N
MW231.34 g/mol
LogP2.55
Rot. Bonds5

About 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid

2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid (PubChem CID 105352893) has the molecular formula C9H13NO2S2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid.

Molecular Properties

Compound Name2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid
PubChem CID105352893
Molecular FormulaC9H13NO2S2
Molecular Weight231.34 g/mol
Exact Mass231.04
IUPAC Name2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid
SMILESCCC(SCc1nc(C)cs1)C(=O)O
InChIInChI=1S/C9H13NO2S2/c1-3-7(9(11)12)13-5-8-10-6(2)4-14-8/h4,7H,3,5H2,1-2H3,(H,11,12)
InChIKeyFBDWXQCARUVNCD-UHFFFAOYSA-N
XLogP2.55
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.34
LogP ≤ 52.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid?
The IUPAC name of 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid (CID 105352893) is 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid.
What is the SMILES notation for 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid?
The canonical SMILES for 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid is CCC(SCc1nc(C)cs1)C(=O)O.
What is the InChIKey of 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid?
The InChIKey is FBDWXQCARUVNCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S2/c1-3-7(9(11)12)13-5-8-10-6(2)4-14-8/h4,7H,3,5H2,1-2H3,(H,11,12).
What are the key properties of 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid?
2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid has a molecular weight of 231.34 g/mol, XLogP of 2.55, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4-methyl-1,3-thiazol-2-yl)methylsulfanyl]butanoic acid is sourced from PubChem (CID 105352893), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).