C9H16N2O2 — CID 10535493
(4S)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one (PubChem CID 10535493) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (4S)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one.
| Compound Name | (4S)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one |
|---|---|
| PubChem CID | 10535493 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (4S)-4-[(2S,4R)-4-hydroxypyrrolidin-2-yl]piperidin-2-one |
| SMILES | O=C1C[C@@H]([C@@H]2C[C@@H](O)CN2)CCN1 |
| InChI | InChI=1S/C9H16N2O2/c12-7-4-8(11-5-7)6-1-2-10-9(13)3-6/h6-8,11-12H,1-5H2,(H,10,13)/t6-,7+,8-/m0/s1 |
| InChIKey | NXEHNTQMFGAWOU-RNJXMRFFSA-N |
| XLogP | -0.76 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |