2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid

C11H12Cl2O3S — CID 105355502

IUPAC2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid
SMILESCCC(C(=O)O)S(=O)Cc1ccc(Cl)cc1Cl
InChIInChI=1S/C11H12Cl2O3S/c1-2-10(11(14)15)17(16)6-7-3-4-8(12)5-9(7)13/h3-5,10H,2,6H2,1H3,(H,14,15)
InChIKeyLPMCRWLOOMCMSQ-UHFFFAOYSA-N
MW295.19 g/mol
LogP3.11
Rot. Bonds5

About 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid

2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid (PubChem CID 105355502) has the molecular formula C11H12Cl2O3S and a molecular weight of 295.19 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid.

Molecular Properties

Compound Name2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid
PubChem CID105355502
Molecular FormulaC11H12Cl2O3S
Molecular Weight295.19 g/mol
Exact Mass293.99
IUPAC Name2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid
SMILESCCC(C(=O)O)S(=O)Cc1ccc(Cl)cc1Cl
InChIInChI=1S/C11H12Cl2O3S/c1-2-10(11(14)15)17(16)6-7-3-4-8(12)5-9(7)13/h3-5,10H,2,6H2,1H3,(H,14,15)
InChIKeyLPMCRWLOOMCMSQ-UHFFFAOYSA-N
XLogP3.11
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.19
LogP ≤ 53.11
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid?
The IUPAC name of 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid (CID 105355502) is 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid.
What is the SMILES notation for 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid?
The canonical SMILES for 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid is CCC(C(=O)O)S(=O)Cc1ccc(Cl)cc1Cl.
What is the InChIKey of 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid?
The InChIKey is LPMCRWLOOMCMSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12Cl2O3S/c1-2-10(11(14)15)17(16)6-7-3-4-8(12)5-9(7)13/h3-5,10H,2,6H2,1H3,(H,14,15).
What are the key properties of 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid?
2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid has a molecular weight of 295.19 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dichlorophenyl)methylsulfinyl]butanoic acid is sourced from PubChem (CID 105355502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).