C11H20N4O3S — CID 105359302
3-amino-1,5-dimethyl-N-(4-methyloxan-4-yl)pyrazole-4-sulfonamide (PubChem CID 105359302) has the molecular formula C11H20N4O3S and a molecular weight of 288.37 g/mol. Its IUPAC name is 3-amino-1,5-dimethyl-N-(4-methyloxan-4-yl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1,5-dimethyl-N-(4-methyloxan-4-yl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105359302 |
| Molecular Formula | C11H20N4O3S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 3-amino-1,5-dimethyl-N-(4-methyloxan-4-yl)pyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NC2(C)CCOCC2)c(N)nn1C |
| InChI | InChI=1S/C11H20N4O3S/c1-8-9(10(12)13-15(8)3)19(16,17)14-11(2)4-6-18-7-5-11/h14H,4-7H2,1-3H3,(H2,12,13) |
| InChIKey | DARGKZUFGQFBDS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |