C10H16O4 — CID 10536024
methyl 2-[(2S,3R,5S)-5-formyl-2,3-dimethyloxolan-2-yl]acetate (PubChem CID 10536024) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is methyl 2-[(2S,3R,5S)-5-formyl-2,3-dimethyloxolan-2-yl]acetate.
| Compound Name | methyl 2-[(2S,3R,5S)-5-formyl-2,3-dimethyloxolan-2-yl]acetate |
|---|---|
| PubChem CID | 10536024 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | methyl 2-[(2S,3R,5S)-5-formyl-2,3-dimethyloxolan-2-yl]acetate |
| SMILES | COC(=O)C[C@]1(C)O[C@H](C=O)C[C@H]1C |
| InChI | InChI=1S/C10H16O4/c1-7-4-8(6-11)14-10(7,2)5-9(12)13-3/h6-8H,4-5H2,1-3H3/t7-,8+,10+/m1/s1 |
| InChIKey | ZGBBQEFKMJFJTM-WEDXCCLWSA-N |
| XLogP | 0.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|