C10H20BrNO2S — CID 105361766
N-(1-bromo-2-methylbutan-2-yl)cyclopentanesulfonamide (PubChem CID 105361766) has the molecular formula C10H20BrNO2S and a molecular weight of 298.25 g/mol. Its IUPAC name is N-(1-bromo-2-methylbutan-2-yl)cyclopentanesulfonamide.
| Compound Name | N-(1-bromo-2-methylbutan-2-yl)cyclopentanesulfonamide |
|---|---|
| PubChem CID | 105361766 |
| Molecular Formula | C10H20BrNO2S |
| Molecular Weight | 298.25 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | N-(1-bromo-2-methylbutan-2-yl)cyclopentanesulfonamide |
| SMILES | CCC(C)(CBr)NS(=O)(=O)C1CCCC1 |
| InChI | InChI=1S/C10H20BrNO2S/c1-3-10(2,8-11)12-15(13,14)9-6-4-5-7-9/h9,12H,3-8H2,1-2H3 |
| InChIKey | LYMMTGUQDMETHE-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|