C13H19N3O3 — CID 105365969
4-(3,5-dimethoxypyrazin-2-yl)-1-azabicyclo[3.2.1]octan-4-ol (PubChem CID 105365969) has the molecular formula C13H19N3O3 and a molecular weight of 265.31 g/mol. Its IUPAC name is 4-(3,5-dimethoxypyrazin-2-yl)-1-azabicyclo[3.2.1]octan-4-ol.
| Compound Name | 4-(3,5-dimethoxypyrazin-2-yl)-1-azabicyclo[3.2.1]octan-4-ol |
|---|---|
| PubChem CID | 105365969 |
| Molecular Formula | C13H19N3O3 |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.14 |
| IUPAC Name | 4-(3,5-dimethoxypyrazin-2-yl)-1-azabicyclo[3.2.1]octan-4-ol |
| SMILES | COc1cnc(C2(O)CCN3CCC2C3)c(OC)n1 |
| InChI | InChI=1S/C13H19N3O3/c1-18-10-7-14-11(12(15-10)19-2)13(17)4-6-16-5-3-9(13)8-16/h7,9,17H,3-6,8H2,1-2H3 |
| InChIKey | IRQGMZUHKVKUIV-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 67.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |