C10H7N3OS — CID 10536743
3-(4-methylphenyl)-4-oxido-1,2,4-thiadiazol-4-ium-5-carbonitrile (PubChem CID 10536743) has the molecular formula C10H7N3OS and a molecular weight of 217.25 g/mol. Its IUPAC name is 3-(4-methylphenyl)-4-oxido-1,2,4-thiadiazol-4-ium-5-carbonitrile.
| Compound Name | 3-(4-methylphenyl)-4-oxido-1,2,4-thiadiazol-4-ium-5-carbonitrile |
|---|---|
| PubChem CID | 10536743 |
| Molecular Formula | C10H7N3OS |
| Molecular Weight | 217.25 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 3-(4-methylphenyl)-4-oxido-1,2,4-thiadiazol-4-ium-5-carbonitrile |
| SMILES | Cc1ccc(-c2nsc(C#N)[n+]2[O-])cc1 |
| InChI | InChI=1S/C10H7N3OS/c1-7-2-4-8(5-3-7)10-12-15-9(6-11)13(10)14/h2-5H,1H3 |
| InChIKey | SPKVJOHEPVYIAD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 63.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.25 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|