C8H10ClN3O — CID 105369688
[1-[(5-chloropyrimidin-4-yl)amino]cyclopropyl]methanol (PubChem CID 105369688) has the molecular formula C8H10ClN3O and a molecular weight of 199.64 g/mol. Its IUPAC name is [1-[(5-chloropyrimidin-4-yl)amino]cyclopropyl]methanol.
| Compound Name | [1-[(5-chloropyrimidin-4-yl)amino]cyclopropyl]methanol |
|---|---|
| PubChem CID | 105369688 |
| Molecular Formula | C8H10ClN3O |
| Molecular Weight | 199.64 g/mol |
| Exact Mass | 199.05 |
| IUPAC Name | [1-[(5-chloropyrimidin-4-yl)amino]cyclopropyl]methanol |
| SMILES | OCC1(Nc2ncncc2Cl)CC1 |
| InChI | InChI=1S/C8H10ClN3O/c9-6-3-10-5-11-7(6)12-8(4-13)1-2-8/h3,5,13H,1-2,4H2,(H,10,11,12) |
| InChIKey | QCIIAOPLVNDCNT-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.64 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |