C10H14BrN3O2 — CID 106299315
[4-[(5-bromopyrimidin-4-yl)amino]oxan-4-yl]methanol (PubChem CID 106299315) has the molecular formula C10H14BrN3O2 and a molecular weight of 288.14 g/mol. Its IUPAC name is [4-[(5-bromopyrimidin-4-yl)amino]oxan-4-yl]methanol.
| Compound Name | [4-[(5-bromopyrimidin-4-yl)amino]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106299315 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.14 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | [4-[(5-bromopyrimidin-4-yl)amino]oxan-4-yl]methanol |
| SMILES | OCC1(Nc2ncncc2Br)CCOCC1 |
| InChI | InChI=1S/C10H14BrN3O2/c11-8-5-12-7-13-9(8)14-10(6-15)1-3-16-4-2-10/h5,7,15H,1-4,6H2,(H,12,13,14) |
| InChIKey | KIVGWXJNURKCKV-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 67.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.14 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |