C14H18N4O2 — CID 106296813
[4-[(6-aminoquinazolin-4-yl)amino]oxan-4-yl]methanol (PubChem CID 106296813) has the molecular formula C14H18N4O2 and a molecular weight of 274.32 g/mol. Its IUPAC name is [4-[(6-aminoquinazolin-4-yl)amino]oxan-4-yl]methanol.
| Compound Name | [4-[(6-aminoquinazolin-4-yl)amino]oxan-4-yl]methanol |
|---|---|
| PubChem CID | 106296813 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [4-[(6-aminoquinazolin-4-yl)amino]oxan-4-yl]methanol |
| SMILES | Nc1ccc2ncnc(NC3(CO)CCOCC3)c2c1 |
| InChI | InChI=1S/C14H18N4O2/c15-10-1-2-12-11(7-10)13(17-9-16-12)18-14(8-19)3-5-20-6-4-14/h1-2,7,9,19H,3-6,8,15H2,(H,16,17,18) |
| InChIKey | RAUGKNYFPYDTSM-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|