C11H17BrN4 — CID 66318043
N-[1-(aminomethyl)cyclohexyl]-5-bromopyrimidin-4-amine (PubChem CID 66318043) has the molecular formula C11H17BrN4 and a molecular weight of 285.19 g/mol. Its IUPAC name is N-[1-(aminomethyl)cyclohexyl]-5-bromopyrimidin-4-amine.
| Compound Name | N-[1-(aminomethyl)cyclohexyl]-5-bromopyrimidin-4-amine |
|---|---|
| PubChem CID | 66318043 |
| Molecular Formula | C11H17BrN4 |
| Molecular Weight | 285.19 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | N-[1-(aminomethyl)cyclohexyl]-5-bromopyrimidin-4-amine |
| SMILES | NCC1(Nc2ncncc2Br)CCCCC1 |
| InChI | InChI=1S/C11H17BrN4/c12-9-6-14-8-15-10(9)16-11(7-13)4-2-1-3-5-11/h6,8H,1-5,7,13H2,(H,14,15,16) |
| InChIKey | RVSBUNBGXSEIRS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.19 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |