C8H12N4O — CID 102987396
[1-[(3-aminopyrazin-2-yl)amino]cyclopropyl]methanol (PubChem CID 102987396) has the molecular formula C8H12N4O and a molecular weight of 180.21 g/mol. Its IUPAC name is [1-[(3-aminopyrazin-2-yl)amino]cyclopropyl]methanol.
| Compound Name | [1-[(3-aminopyrazin-2-yl)amino]cyclopropyl]methanol |
|---|---|
| PubChem CID | 102987396 |
| Molecular Formula | C8H12N4O |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | [1-[(3-aminopyrazin-2-yl)amino]cyclopropyl]methanol |
| SMILES | Nc1nccnc1NC1(CO)CC1 |
| InChI | InChI=1S/C8H12N4O/c9-6-7(11-4-3-10-6)12-8(5-13)1-2-8/h3-4,13H,1-2,5H2,(H2,9,10)(H,11,12) |
| InChIKey | OQTKWOBXYQVXHE-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |