C17H19FO2 — CID 105372818
2-(5-fluoro-2-methylphenyl)-1-[5-(2-methylcyclopropyl)furan-2-yl]ethanol (PubChem CID 105372818) has the molecular formula C17H19FO2 and a molecular weight of 274.33 g/mol. Its IUPAC name is 2-(5-fluoro-2-methylphenyl)-1-[5-(2-methylcyclopropyl)furan-2-yl]ethanol.
| Compound Name | 2-(5-fluoro-2-methylphenyl)-1-[5-(2-methylcyclopropyl)furan-2-yl]ethanol |
|---|---|
| PubChem CID | 105372818 |
| Molecular Formula | C17H19FO2 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2-(5-fluoro-2-methylphenyl)-1-[5-(2-methylcyclopropyl)furan-2-yl]ethanol |
| SMILES | Cc1ccc(F)cc1CC(O)c1ccc(C2CC2C)o1 |
| InChI | InChI=1S/C17H19FO2/c1-10-3-4-13(18)8-12(10)9-15(19)17-6-5-16(20-17)14-7-11(14)2/h3-6,8,11,14-15,19H,7,9H2,1-2H3 |
| InChIKey | HJTMZRUKXFLVLK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |