C10H8ClF3O — CID 105373359
1-chloro-1,1-difluoro-3-(5-fluoro-2-methylphenyl)propan-2-one (PubChem CID 105373359) has the molecular formula C10H8ClF3O and a molecular weight of 236.62 g/mol. Its IUPAC name is 1-chloro-1,1-difluoro-3-(5-fluoro-2-methylphenyl)propan-2-one.
| Compound Name | 1-chloro-1,1-difluoro-3-(5-fluoro-2-methylphenyl)propan-2-one |
|---|---|
| PubChem CID | 105373359 |
| Molecular Formula | C10H8ClF3O |
| Molecular Weight | 236.62 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 1-chloro-1,1-difluoro-3-(5-fluoro-2-methylphenyl)propan-2-one |
| SMILES | Cc1ccc(F)cc1CC(=O)C(F)(F)Cl |
| InChI | InChI=1S/C10H8ClF3O/c1-6-2-3-8(12)4-7(6)5-9(15)10(11,13)14/h2-4H,5H2,1H3 |
| InChIKey | FGUKAGUNSBSRBR-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.62 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|