C13H16ClF — CID 105375583
2-[(3-chlorocyclopentyl)methyl]-4-fluoro-1-methylbenzene (PubChem CID 105375583) has the molecular formula C13H16ClF and a molecular weight of 226.72 g/mol. Its IUPAC name is 2-[(3-chlorocyclopentyl)methyl]-4-fluoro-1-methylbenzene.
| Compound Name | 2-[(3-chlorocyclopentyl)methyl]-4-fluoro-1-methylbenzene |
|---|---|
| PubChem CID | 105375583 |
| Molecular Formula | C13H16ClF |
| Molecular Weight | 226.72 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 2-[(3-chlorocyclopentyl)methyl]-4-fluoro-1-methylbenzene |
| SMILES | Cc1ccc(F)cc1CC1CCC(Cl)C1 |
| InChI | InChI=1S/C13H16ClF/c1-9-2-5-13(15)8-11(9)6-10-3-4-12(14)7-10/h2,5,8,10,12H,3-4,6-7H2,1H3 |
| InChIKey | GDSFSPWVRNRXNT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.72 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|