C14H19NO2 — CID 10537597
7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione (PubChem CID 10537597) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione.
| Compound Name | 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione |
|---|---|
| PubChem CID | 10537597 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione |
| SMILES | C=CCN1CC(=C)C2(CC(C)(C)CC2=O)C1=O |
| InChI | InChI=1S/C14H19NO2/c1-5-6-15-8-10(2)14(12(15)17)9-13(3,4)7-11(14)16/h5H,1-2,6-9H2,3-4H3 |
| InChIKey | FOWBHRJYJWODLR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|