About 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione
7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione (PubChem CID 10537597) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione.
Molecular Properties
| Compound Name | 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione |
| PubChem CID | 10537597 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione |
| SMILES | C=CCN1CC(=C)C2(CC(C)(C)CC2=O)C1=O |
| InChI | InChI=1S/C14H19NO2/c1-5-6-15-8-10(2)14(12(15)17)9-13(3,4)7-11(14)16/h5H,1-2,6-9H2,3-4H3 |
| InChIKey | FOWBHRJYJWODLR-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione?
The IUPAC name of 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione (CID 10537597) is 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione.
What is the SMILES notation for 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione?
The canonical SMILES for 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione is C=CCN1CC(=C)C2(CC(C)(C)CC2=O)C1=O.
What is the InChIKey of 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione?
The InChIKey is FOWBHRJYJWODLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-5-6-15-8-10(2)14(12(15)17)9-13(3,4)7-11(14)16/h5H,1-2,6-9H2,3-4H3.
What are the key properties of 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione?
7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione has a molecular weight of 233.31 g/mol, XLogP of 1.95, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7,7-dimethyl-4-methylidene-2-prop-2-enyl-2-azaspiro[4.4]nonane-1,9-dione is sourced from PubChem (CID 10537597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).