C13H22O4 — CID 10538113
methyl 3-(1,4-dioxaspiro[4.6]undecan-6-yl)propanoate (PubChem CID 10538113) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is methyl 3-(1,4-dioxaspiro[4.6]undecan-6-yl)propanoate.
| Compound Name | methyl 3-(1,4-dioxaspiro[4.6]undecan-6-yl)propanoate |
|---|---|
| PubChem CID | 10538113 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | methyl 3-(1,4-dioxaspiro[4.6]undecan-6-yl)propanoate |
| SMILES | COC(=O)CCC1CCCCCC12OCCO2 |
| InChI | InChI=1S/C13H22O4/c1-15-12(14)7-6-11-5-3-2-4-8-13(11)16-9-10-17-13/h11H,2-10H2,1H3 |
| InChIKey | OWRYUIWCSYLCPF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |