C16H27IO4 — CID 134866188
(3R,5S,6S)-6-[(1S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-iodobutyl]-3,5-dimethyloxan-2-one (PubChem CID 134866188) has the molecular formula C16H27IO4 and a molecular weight of 410.29 g/mol. Its IUPAC name is (3R,5S,6S)-6-[(1S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-iodobutyl]-3,5-dimethyloxan-2-one.
| Compound Name | (3R,5S,6S)-6-[(1S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-iodobutyl]-3,5-dimethyloxan-2-one |
|---|---|
| PubChem CID | 134866188 |
| Molecular Formula | C16H27IO4 |
| Molecular Weight | 410.29 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (3R,5S,6S)-6-[(1S,3S)-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-iodobutyl]-3,5-dimethyloxan-2-one |
| SMILES | C[C@@H]1C[C@H](C)[C@@H]([C@@H](I)C[C@H](C)[C@@H]2COC(C)(C)O2)OC1=O |
| InChI | InChI=1S/C16H27IO4/c1-9(13-8-19-16(4,5)21-13)7-12(17)14-10(2)6-11(3)15(18)20-14/h9-14H,6-8H2,1-5H3/t9-,10-,11+,12-,13-,14-/m0/s1 |
| InChIKey | GQKKFMHWROFDJQ-XQZGEAEESA-N |
| XLogP | 3.56 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|