C9H10FN7O — CID 105387045
3-fluoro-2-(methylamino)-N-(2-methyltetrazol-5-yl)pyridine-4-carboxamide (PubChem CID 105387045) has the molecular formula C9H10FN7O and a molecular weight of 251.22 g/mol. Its IUPAC name is 3-fluoro-2-(methylamino)-N-(2-methyltetrazol-5-yl)pyridine-4-carboxamide.
| Compound Name | 3-fluoro-2-(methylamino)-N-(2-methyltetrazol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105387045 |
| Molecular Formula | C9H10FN7O |
| Molecular Weight | 251.22 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 3-fluoro-2-(methylamino)-N-(2-methyltetrazol-5-yl)pyridine-4-carboxamide |
| SMILES | CNc1nccc(C(=O)Nc2nnn(C)n2)c1F |
| InChI | InChI=1S/C9H10FN7O/c1-11-7-6(10)5(3-4-12-7)8(18)13-9-14-16-17(2)15-9/h3-4H,1-2H3,(H,11,12)(H,13,15,18) |
| InChIKey | KYNOQWVIRUECBU-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 97.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.22 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |