C8H6F2N6O — CID 105381449
2,3-difluoro-N-(2-methyltetrazol-5-yl)pyridine-4-carboxamide (PubChem CID 105381449) has the molecular formula C8H6F2N6O and a molecular weight of 240.17 g/mol. Its IUPAC name is 2,3-difluoro-N-(2-methyltetrazol-5-yl)pyridine-4-carboxamide.
| Compound Name | 2,3-difluoro-N-(2-methyltetrazol-5-yl)pyridine-4-carboxamide |
|---|---|
| PubChem CID | 105381449 |
| Molecular Formula | C8H6F2N6O |
| Molecular Weight | 240.17 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2,3-difluoro-N-(2-methyltetrazol-5-yl)pyridine-4-carboxamide |
| SMILES | Cn1nnc(NC(=O)c2ccnc(F)c2F)n1 |
| InChI | InChI=1S/C8H6F2N6O/c1-16-14-8(13-15-16)12-7(17)4-2-3-11-6(10)5(4)9/h2-3H,1H3,(H,12,14,17) |
| InChIKey | YDGQWTLPHFSYFW-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.17 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|