C12H12N8O — CID 106774275
1-hydrazinyl-N-(2-methyltetrazol-5-yl)isoquinoline-4-carboxamide (PubChem CID 106774275) has the molecular formula C12H12N8O and a molecular weight of 284.28 g/mol. Its IUPAC name is 1-hydrazinyl-N-(2-methyltetrazol-5-yl)isoquinoline-4-carboxamide.
| Compound Name | 1-hydrazinyl-N-(2-methyltetrazol-5-yl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106774275 |
| Molecular Formula | C12H12N8O |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | 1-hydrazinyl-N-(2-methyltetrazol-5-yl)isoquinoline-4-carboxamide |
| SMILES | Cn1nnc(NC(=O)c2cnc(NN)c3ccccc23)n1 |
| InChI | InChI=1S/C12H12N8O/c1-20-18-12(17-19-20)15-11(21)9-6-14-10(16-13)8-5-3-2-4-7(8)9/h2-6H,13H2,1H3,(H,14,16)(H,15,18,21) |
| InChIKey | DUKQWNPODJHCME-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 123.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|