C14H13N5O2 — CID 106773338
1-hydrazinyl-N-(3-methyl-1,2-oxazol-5-yl)isoquinoline-4-carboxamide (PubChem CID 106773338) has the molecular formula C14H13N5O2 and a molecular weight of 283.29 g/mol. Its IUPAC name is 1-hydrazinyl-N-(3-methyl-1,2-oxazol-5-yl)isoquinoline-4-carboxamide.
| Compound Name | 1-hydrazinyl-N-(3-methyl-1,2-oxazol-5-yl)isoquinoline-4-carboxamide |
|---|---|
| PubChem CID | 106773338 |
| Molecular Formula | C14H13N5O2 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 1-hydrazinyl-N-(3-methyl-1,2-oxazol-5-yl)isoquinoline-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cnc(NN)c3ccccc23)on1 |
| InChI | InChI=1S/C14H13N5O2/c1-8-6-12(21-19-8)17-14(20)11-7-16-13(18-15)10-5-3-2-4-9(10)11/h2-7H,15H2,1H3,(H,16,18)(H,17,20) |
| InChIKey | UVVPFGZNQDAVJZ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|