C14H24O2S — CID 10539030
methyl 2-[[(4R,6S)-6-methyl-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate (PubChem CID 10539030) has the molecular formula C14H24O2S and a molecular weight of 256.41 g/mol. Its IUPAC name is methyl 2-[[(4R,6S)-6-methyl-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate.
| Compound Name | methyl 2-[[(4R,6S)-6-methyl-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 10539030 |
| Molecular Formula | C14H24O2S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | methyl 2-[[(4R,6S)-6-methyl-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate |
| SMILES | COC(=O)CSCC1=CC[C@@H](C(C)C)C[C@@H]1C |
| InChI | InChI=1S/C14H24O2S/c1-10(2)12-5-6-13(11(3)7-12)8-17-9-14(15)16-4/h6,10-12H,5,7-9H2,1-4H3/t11-,12+/m0/s1 |
| InChIKey | SUXXAZXEXDAQEK-NWDGAFQWSA-N |
| XLogP | 3.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|