C12H18O2S — CID 170995165
2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylsulfanyl]acetic acid (PubChem CID 170995165) has the molecular formula C12H18O2S and a molecular weight of 226.34 g/mol. Its IUPAC name is 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 170995165 |
| Molecular Formula | C12H18O2S |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-[[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylsulfanyl]acetic acid |
| SMILES | CC1(C)[C@H]2CC=C(CSCC(=O)O)[C@@H]1C2 |
| InChI | InChI=1S/C12H18O2S/c1-12(2)9-4-3-8(10(12)5-9)6-15-7-11(13)14/h3,9-10H,4-7H2,1-2H3,(H,13,14)/t9-,10-/m0/s1 |
| InChIKey | WJBAYLBPBORPAM-UWVGGRQHSA-N |
| XLogP | 2.80 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|