C13H22O3S — CID 10539157
methyl 2-[[(4R,6S)-6-hydroxy-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate (PubChem CID 10539157) has the molecular formula C13H22O3S and a molecular weight of 258.38 g/mol. Its IUPAC name is methyl 2-[[(4R,6S)-6-hydroxy-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate.
| Compound Name | methyl 2-[[(4R,6S)-6-hydroxy-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 10539157 |
| Molecular Formula | C13H22O3S |
| Molecular Weight | 258.38 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | methyl 2-[[(4R,6S)-6-hydroxy-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate |
| SMILES | COC(=O)CSCC1=CC[C@@H](C(C)C)C[C@@H]1O |
| InChI | InChI=1S/C13H22O3S/c1-9(2)10-4-5-11(12(14)6-10)7-17-8-13(15)16-3/h5,9-10,12,14H,4,6-8H2,1-3H3/t10-,12+/m1/s1 |
| InChIKey | HUCJQAYNJREIOG-PWSUYJOCSA-N |
| XLogP | 2.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|