C14H24O3S — CID 10707364
methyl 2-[[(4R,6S)-6-(hydroxymethyl)-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate (PubChem CID 10707364) has the molecular formula C14H24O3S and a molecular weight of 272.41 g/mol. Its IUPAC name is methyl 2-[[(4R,6S)-6-(hydroxymethyl)-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate.
| Compound Name | methyl 2-[[(4R,6S)-6-(hydroxymethyl)-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate |
|---|---|
| PubChem CID | 10707364 |
| Molecular Formula | C14H24O3S |
| Molecular Weight | 272.41 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | methyl 2-[[(4R,6S)-6-(hydroxymethyl)-4-propan-2-ylcyclohexen-1-yl]methylsulfanyl]acetate |
| SMILES | COC(=O)CSCC1=CC[C@@H](C(C)C)C[C@@H]1CO |
| InChI | InChI=1S/C14H24O3S/c1-10(2)11-4-5-12(13(6-11)7-15)8-18-9-14(16)17-3/h5,10-11,13,15H,4,6-9H2,1-3H3/t11-,13-/m1/s1 |
| InChIKey | FQBJVSSQYICXHA-DGCLKSJQSA-N |
| XLogP | 2.49 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.41 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|