C17H30O3S — CID 176571437
4-hydroxybutyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate (PubChem CID 176571437) has the molecular formula C17H30O3S and a molecular weight of 314.49 g/mol. Its IUPAC name is 4-hydroxybutyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate.
| Compound Name | 4-hydroxybutyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 176571437 |
| Molecular Formula | C17H30O3S |
| Molecular Weight | 314.49 g/mol |
| Exact Mass | 314.19 |
| IUPAC Name | 4-hydroxybutyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate |
| SMILES | CC1=CC(SCCC(=O)OCCCCO)C(C(C)C)CC1 |
| InChI | InChI=1S/C17H30O3S/c1-13(2)15-7-6-14(3)12-16(15)21-11-8-17(19)20-10-5-4-9-18/h12-13,15-16,18H,4-11H2,1-3H3 |
| InChIKey | KHGXDSPKOZJRSF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.49 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|