C21H38O2S — CID 176571466
2-ethylhexyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate (PubChem CID 176571466) has the molecular formula C21H38O2S and a molecular weight of 354.60 g/mol. Its IUPAC name is 2-ethylhexyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate.
| Compound Name | 2-ethylhexyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate |
|---|---|
| PubChem CID | 176571466 |
| Molecular Formula | C21H38O2S |
| Molecular Weight | 354.60 g/mol |
| Exact Mass | 354.26 |
| IUPAC Name | 2-ethylhexyl 3-(3-methyl-6-propan-2-ylcyclohex-2-en-1-yl)sulfanylpropanoate |
| SMILES | CCCCC(CC)COC(=O)CCSC1C=C(C)CCC1C(C)C |
| InChI | InChI=1S/C21H38O2S/c1-6-8-9-18(7-2)15-23-21(22)12-13-24-20-14-17(5)10-11-19(20)16(3)4/h14,16,18-20H,6-13,15H2,1-5H3 |
| InChIKey | GMIJVXPRJCTBGV-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.60 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|