C18H32O3S — CID 134928129
[(6Z)-3,7,11-trimethyl-9-methylsulfinyldodeca-6,10-dienyl] acetate (PubChem CID 134928129) has the molecular formula C18H32O3S and a molecular weight of 328.52 g/mol. Its IUPAC name is [(6Z)-3,7,11-trimethyl-9-methylsulfinyldodeca-6,10-dienyl] acetate.
| Compound Name | [(6Z)-3,7,11-trimethyl-9-methylsulfinyldodeca-6,10-dienyl] acetate |
|---|---|
| PubChem CID | 134928129 |
| Molecular Formula | C18H32O3S |
| Molecular Weight | 328.52 g/mol |
| Exact Mass | 328.21 |
| IUPAC Name | [(6Z)-3,7,11-trimethyl-9-methylsulfinyldodeca-6,10-dienyl] acetate |
| SMILES | CC(=O)OCCC(C)CC/C=C(/C)CC(C=C(C)C)S(C)=O |
| InChI | InChI=1S/C18H32O3S/c1-14(2)12-18(22(6)20)13-16(4)9-7-8-15(3)10-11-21-17(5)19/h9,12,15,18H,7-8,10-11,13H2,1-6H3/b16-9- |
| InChIKey | SGXGIDFTOSYWQC-SXGWCWSVSA-N |
| XLogP | 4.41 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|