C14H20F3N3O — CID 105391908
[3-[4-(trifluoromethyl)cyclohexyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol (PubChem CID 105391908) has the molecular formula C14H20F3N3O and a molecular weight of 303.33 g/mol. Its IUPAC name is [3-[4-(trifluoromethyl)cyclohexyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol.
| Compound Name | [3-[4-(trifluoromethyl)cyclohexyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 105391908 |
| Molecular Formula | C14H20F3N3O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | [3-[4-(trifluoromethyl)cyclohexyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
| SMILES | OCC1CCc2nnc(C3CCC(C(F)(F)F)CC3)n2C1 |
| InChI | InChI=1S/C14H20F3N3O/c15-14(16,17)11-4-2-10(3-5-11)13-19-18-12-6-1-9(8-21)7-20(12)13/h9-11,21H,1-8H2 |
| InChIKey | OGRKIJKEHNJCBK-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |