C10H14F3N3O2 — CID 103217888
[3-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol (PubChem CID 103217888) has the molecular formula C10H14F3N3O2 and a molecular weight of 265.23 g/mol. Its IUPAC name is [3-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol.
| Compound Name | [3-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
|---|---|
| PubChem CID | 103217888 |
| Molecular Formula | C10H14F3N3O2 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | [3-(2,2,2-trifluoroethoxymethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]methanol |
| SMILES | OCC1CCc2nnc(COCC(F)(F)F)n2C1 |
| InChI | InChI=1S/C10H14F3N3O2/c11-10(12,13)6-18-5-9-15-14-8-2-1-7(4-17)3-16(8)9/h7,17H,1-6H2 |
| InChIKey | VIHPOPSAZWDHAW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |