About 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile
3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile (PubChem CID 105392928) has the molecular formula C9H8N4
and a molecular weight of 172.19 g/mol. Its IUPAC name is 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile.
Analyze 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile?
The IUPAC name of 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile (CID 105392928) is 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile.
What is the SMILES notation for 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile?
The canonical SMILES for 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile is CCc1nnc2cc(C#N)ccn12.
What is the InChIKey of 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile?
The InChIKey is NFDZHVRUCBNDEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4/c1-2-8-11-12-9-5-7(6-10)3-4-13(8)9/h3-5H,2H2,1H3.
What are the key properties of 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile?
3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile has a molecular weight of 172.19 g/mol, XLogP of 1.16, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-[1,2,4]triazolo[4,3-a]pyridine-7-carbonitrile is sourced from PubChem (CID 105392928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).