C13H17ClFNO — CID 105393974
4-(2-chloro-5-fluorophenyl)-1,2-dimethylpiperidin-4-ol (PubChem CID 105393974) has the molecular formula C13H17ClFNO and a molecular weight of 257.74 g/mol. Its IUPAC name is 4-(2-chloro-5-fluorophenyl)-1,2-dimethylpiperidin-4-ol.
| Compound Name | 4-(2-chloro-5-fluorophenyl)-1,2-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 105393974 |
| Molecular Formula | C13H17ClFNO |
| Molecular Weight | 257.74 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | 4-(2-chloro-5-fluorophenyl)-1,2-dimethylpiperidin-4-ol |
| SMILES | CC1CC(O)(c2cc(F)ccc2Cl)CCN1C |
| InChI | InChI=1S/C13H17ClFNO/c1-9-8-13(17,5-6-16(9)2)11-7-10(15)3-4-12(11)14/h3-4,7,9,17H,5-6,8H2,1-2H3 |
| InChIKey | YQHDTUZNEUAHBJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.74 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |