C18H17Cl4NO — CID 173233695
2,4-bis(3,4-dichlorophenyl)-1-methylpiperidin-4-ol (PubChem CID 173233695) has the molecular formula C18H17Cl4NO and a molecular weight of 405.15 g/mol. Its IUPAC name is 2,4-bis(3,4-dichlorophenyl)-1-methylpiperidin-4-ol.
| Compound Name | 2,4-bis(3,4-dichlorophenyl)-1-methylpiperidin-4-ol |
|---|---|
| PubChem CID | 173233695 |
| Molecular Formula | C18H17Cl4NO |
| Molecular Weight | 405.15 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 2,4-bis(3,4-dichlorophenyl)-1-methylpiperidin-4-ol |
| SMILES | CN1CCC(O)(c2ccc(Cl)c(Cl)c2)CC1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H17Cl4NO/c1-23-7-6-18(24,12-3-5-14(20)16(22)9-12)10-17(23)11-2-4-13(19)15(21)8-11/h2-5,8-9,17,24H,6-7,10H2,1H3 |
| InChIKey | ZBHXEKAINGQMRZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.15 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |