C17H25NO — CID 116505443
4-(4-cyclobutylphenyl)-1,2-dimethylpiperidin-4-ol (PubChem CID 116505443) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 4-(4-cyclobutylphenyl)-1,2-dimethylpiperidin-4-ol.
| Compound Name | 4-(4-cyclobutylphenyl)-1,2-dimethylpiperidin-4-ol |
|---|---|
| PubChem CID | 116505443 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 4-(4-cyclobutylphenyl)-1,2-dimethylpiperidin-4-ol |
| SMILES | CC1CC(O)(c2ccc(C3CCC3)cc2)CCN1C |
| InChI | InChI=1S/C17H25NO/c1-13-12-17(19,10-11-18(13)2)16-8-6-15(7-9-16)14-4-3-5-14/h6-9,13-14,19H,3-5,10-12H2,1-2H3 |
| InChIKey | AAEQCYPHWYQQTB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |