C12H16BrNO3 — CID 105405910
ethyl 2-amino-3-(3-bromo-4-methylphenyl)-3-hydroxypropanoate (PubChem CID 105405910) has the molecular formula C12H16BrNO3 and a molecular weight of 302.17 g/mol. Its IUPAC name is ethyl 2-amino-3-(3-bromo-4-methylphenyl)-3-hydroxypropanoate.
| Compound Name | ethyl 2-amino-3-(3-bromo-4-methylphenyl)-3-hydroxypropanoate |
|---|---|
| PubChem CID | 105405910 |
| Molecular Formula | C12H16BrNO3 |
| Molecular Weight | 302.17 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | ethyl 2-amino-3-(3-bromo-4-methylphenyl)-3-hydroxypropanoate |
| SMILES | CCOC(=O)C(N)C(O)c1ccc(C)c(Br)c1 |
| InChI | InChI=1S/C12H16BrNO3/c1-3-17-12(16)10(14)11(15)8-5-4-7(2)9(13)6-8/h4-6,10-11,15H,3,14H2,1-2H3 |
| InChIKey | GBUZWBNHFCEGQB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |